C25H26BrN3O3S — CID 59820756
ethyl 6-bromo-5-hydroxy-4-(imidazol-1-ylmethyl)-1-methyl-2-(2-phenylethylsulfanylmethyl)indole-3-carboxylate (PubChem CID 59820756) has the molecular formula C25H26BrN3O3S and a molecular weight of 528.47 g/mol. Its IUPAC name is ethyl 6-bromo-5-hydroxy-4-(imidazol-1-ylmethyl)-1-methyl-2-(2-phenylethylsulfanylmethyl)indole-3-carboxylate.
| Compound Name | ethyl 6-bromo-5-hydroxy-4-(imidazol-1-ylmethyl)-1-methyl-2-(2-phenylethylsulfanylmethyl)indole-3-carboxylate |
|---|---|
| PubChem CID | 59820756 |
| Molecular Formula | C25H26BrN3O3S |
| Molecular Weight | 528.47 g/mol |
| Exact Mass | 527.09 |
| IUPAC Name | ethyl 6-bromo-5-hydroxy-4-(imidazol-1-ylmethyl)-1-methyl-2-(2-phenylethylsulfanylmethyl)indole-3-carboxylate |
| SMILES | CCOC(=O)c1c(CSCCc2ccccc2)n(C)c2cc(Br)c(O)c(Cn3ccnc3)c12 |
| InChI | InChI=1S/C25H26BrN3O3S/c1-3-32-25(31)23-21(15-33-12-9-17-7-5-4-6-8-17)28(2)20-13-19(26)24(30)18(22(20)23)14-29-11-10-27-16-29/h4-8,10-11,13,16,30H,3,9,12,14-15H2,1-2H3 |
| InChIKey | WRQUOYVSYCUSNF-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 69.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.47 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|