C27H28BrN3O3S — CID 67242565
ethyl 6-bromo-1-cyclopropyl-2-[ethylsulfanyl(phenyl)methyl]-5-hydroxy-4-(imidazol-1-ylmethyl)indole-3-carboxylate (PubChem CID 67242565) has the molecular formula C27H28BrN3O3S and a molecular weight of 554.51 g/mol. Its IUPAC name is ethyl 6-bromo-1-cyclopropyl-2-[ethylsulfanyl(phenyl)methyl]-5-hydroxy-4-(imidazol-1-ylmethyl)indole-3-carboxylate.
| Compound Name | ethyl 6-bromo-1-cyclopropyl-2-[ethylsulfanyl(phenyl)methyl]-5-hydroxy-4-(imidazol-1-ylmethyl)indole-3-carboxylate |
|---|---|
| PubChem CID | 67242565 |
| Molecular Formula | C27H28BrN3O3S |
| Molecular Weight | 554.51 g/mol |
| Exact Mass | 553.10 |
| IUPAC Name | ethyl 6-bromo-1-cyclopropyl-2-[ethylsulfanyl(phenyl)methyl]-5-hydroxy-4-(imidazol-1-ylmethyl)indole-3-carboxylate |
| SMILES | CCOC(=O)c1c(C(SCC)c2ccccc2)n(C2CC2)c2cc(Br)c(O)c(Cn3ccnc3)c12 |
| InChI | InChI=1S/C27H28BrN3O3S/c1-3-34-27(33)23-22-19(15-30-13-12-29-16-30)25(32)20(28)14-21(22)31(18-10-11-18)24(23)26(35-4-2)17-8-6-5-7-9-17/h5-9,12-14,16,18,26,32H,3-4,10-11,15H2,1-2H3 |
| InChIKey | ROHSRLFDBDUAPG-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 69.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.51 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|