C19H21N3O3 — CID 141146638
ethyl 1-cyclopropyl-5-hydroxy-4-(imidazol-1-ylmethyl)-2-methylindole-3-carboxylate (PubChem CID 141146638) has the molecular formula C19H21N3O3 and a molecular weight of 339.40 g/mol. Its IUPAC name is ethyl 1-cyclopropyl-5-hydroxy-4-(imidazol-1-ylmethyl)-2-methylindole-3-carboxylate.
| Compound Name | ethyl 1-cyclopropyl-5-hydroxy-4-(imidazol-1-ylmethyl)-2-methylindole-3-carboxylate |
|---|---|
| PubChem CID | 141146638 |
| Molecular Formula | C19H21N3O3 |
| Molecular Weight | 339.40 g/mol |
| Exact Mass | 339.16 |
| IUPAC Name | ethyl 1-cyclopropyl-5-hydroxy-4-(imidazol-1-ylmethyl)-2-methylindole-3-carboxylate |
| SMILES | CCOC(=O)c1c(C)n(C2CC2)c2ccc(O)c(Cn3ccnc3)c12 |
| InChI | InChI=1S/C19H21N3O3/c1-3-25-19(24)17-12(2)22(13-4-5-13)15-6-7-16(23)14(18(15)17)10-21-9-8-20-11-21/h6-9,11,13,23H,3-5,10H2,1-2H3 |
| InChIKey | WWKBXAJFRQUNRS-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 69.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.40 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|