C26H32ClN3O3S — CID 87872721
ethyl 1-cyclopropyl-5-hydroxy-4-(piperidin-1-ylmethyl)-2-[pyridin-2-yl(sulfanyl)methyl]indole-3-carboxylate;hydrochloride (PubChem CID 87872721) has the molecular formula C26H32ClN3O3S and a molecular weight of 502.08 g/mol. Its IUPAC name is ethyl 1-cyclopropyl-5-hydroxy-4-(piperidin-1-ylmethyl)-2-[pyridin-2-yl(sulfanyl)methyl]indole-3-carboxylate;hydrochloride.
| Compound Name | ethyl 1-cyclopropyl-5-hydroxy-4-(piperidin-1-ylmethyl)-2-[pyridin-2-yl(sulfanyl)methyl]indole-3-carboxylate;hydrochloride |
|---|---|
| PubChem CID | 87872721 |
| Molecular Formula | C26H32ClN3O3S |
| Molecular Weight | 502.08 g/mol |
| Exact Mass | 501.19 |
| IUPAC Name | ethyl 1-cyclopropyl-5-hydroxy-4-(piperidin-1-ylmethyl)-2-[pyridin-2-yl(sulfanyl)methyl]indole-3-carboxylate;hydrochloride |
| SMILES | CCOC(=O)c1c(C(S)c2ccccn2)n(C2CC2)c2ccc(O)c(CN3CCCCC3)c12.Cl |
| InChI | InChI=1S/C26H31N3O3S.ClH/c1-2-32-26(31)23-22-18(16-28-14-6-3-7-15-28)21(30)12-11-20(22)29(17-9-10-17)24(23)25(33)19-8-4-5-13-27-19;/h4-5,8,11-13,17,25,30,33H,2-3,6-7,9-10,14-16H2,1H3;1H |
| InChIKey | XHWBZSQVYWSTIM-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.08 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|