C25H30N2O5S — CID 59820786
ethyl 5-hydroxy-1-methyl-2-[(4-methylphenyl)sulfonylmethyl]-4-(pyrrolidin-1-ylmethyl)indole-3-carboxylate (PubChem CID 59820786) has the molecular formula C25H30N2O5S and a molecular weight of 470.59 g/mol. Its IUPAC name is ethyl 5-hydroxy-1-methyl-2-[(4-methylphenyl)sulfonylmethyl]-4-(pyrrolidin-1-ylmethyl)indole-3-carboxylate.
| Compound Name | ethyl 5-hydroxy-1-methyl-2-[(4-methylphenyl)sulfonylmethyl]-4-(pyrrolidin-1-ylmethyl)indole-3-carboxylate |
|---|---|
| PubChem CID | 59820786 |
| Molecular Formula | C25H30N2O5S |
| Molecular Weight | 470.59 g/mol |
| Exact Mass | 470.19 |
| IUPAC Name | ethyl 5-hydroxy-1-methyl-2-[(4-methylphenyl)sulfonylmethyl]-4-(pyrrolidin-1-ylmethyl)indole-3-carboxylate |
| SMILES | CCOC(=O)c1c(CS(=O)(=O)c2ccc(C)cc2)n(C)c2ccc(O)c(CN3CCCC3)c12 |
| InChI | InChI=1S/C25H30N2O5S/c1-4-32-25(29)24-21(16-33(30,31)18-9-7-17(2)8-10-18)26(3)20-11-12-22(28)19(23(20)24)15-27-13-5-6-14-27/h7-12,28H,4-6,13-16H2,1-3H3 |
| InChIKey | HWXDNJRNOXNWLC-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 88.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.59 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|