C24H28N4O6S — CID 59820708
ethyl 1-cyclopropyl-4-[(diaminomethylideneamino)methyl]-5-hydroxy-2-[(4-methoxyphenyl)sulfonylmethyl]indole-3-carboxylate (PubChem CID 59820708) has the molecular formula C24H28N4O6S and a molecular weight of 500.58 g/mol. Its IUPAC name is ethyl 1-cyclopropyl-4-[(diaminomethylideneamino)methyl]-5-hydroxy-2-[(4-methoxyphenyl)sulfonylmethyl]indole-3-carboxylate.
| Compound Name | ethyl 1-cyclopropyl-4-[(diaminomethylideneamino)methyl]-5-hydroxy-2-[(4-methoxyphenyl)sulfonylmethyl]indole-3-carboxylate |
|---|---|
| PubChem CID | 59820708 |
| Molecular Formula | C24H28N4O6S |
| Molecular Weight | 500.58 g/mol |
| Exact Mass | 500.17 |
| IUPAC Name | ethyl 1-cyclopropyl-4-[(diaminomethylideneamino)methyl]-5-hydroxy-2-[(4-methoxyphenyl)sulfonylmethyl]indole-3-carboxylate |
| SMILES | CCOC(=O)c1c(CS(=O)(=O)c2ccc(OC)cc2)n(C2CC2)c2ccc(O)c(CN=C(N)N)c12 |
| InChI | InChI=1S/C24H28N4O6S/c1-3-34-23(30)22-19(13-35(31,32)16-8-6-15(33-2)7-9-16)28(14-4-5-14)18-10-11-20(29)17(21(18)22)12-27-24(25)26/h6-11,14,29H,3-5,12-13H2,1-2H3,(H4,25,26,27) |
| InChIKey | JDYAQFWVIYUWEO-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 159.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.58 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|