About (4-cyclopropyl-5-methyl-1,2,4-triazol-3-yl)methyl 4-methoxybenzoate
(4-cyclopropyl-5-methyl-1,2,4-triazol-3-yl)methyl 4-methoxybenzoate (PubChem CID 75399835) has the molecular formula C15H17N3O3
and a molecular weight of 287.32 g/mol. Its IUPAC name is (4-cyclopropyl-5-methyl-1,2,4-triazol-3-yl)methyl 4-methoxybenzoate.
Molecular Properties
| Compound Name | (4-cyclopropyl-5-methyl-1,2,4-triazol-3-yl)methyl 4-methoxybenzoate |
| PubChem CID | 75399835 |
| Molecular Formula | C15H17N3O3 |
| Molecular Weight | 287.32 g/mol |
| Exact Mass | 287.13 |
| IUPAC Name | (4-cyclopropyl-5-methyl-1,2,4-triazol-3-yl)methyl 4-methoxybenzoate |
| SMILES | COc1ccc(C(=O)OCc2nnc(C)n2C2CC2)cc1 |
| InChI | InChI=1S/C15H17N3O3/c1-10-16-17-14(18(10)12-5-6-12)9-21-15(19)11-3-7-13(20-2)8-4-11/h3-4,7-8,12H,5-6,9H2,1-2H3 |
| InChIKey | KGRYDINLYRAVFI-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 66.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.32 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (4-cyclopropyl-5-methyl-1,2,4-triazol-3-yl)methyl 4-methoxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-cyclopropyl-5-methyl-1,2,4-triazol-3-yl)methyl 4-methoxybenzoate?
The IUPAC name of (4-cyclopropyl-5-methyl-1,2,4-triazol-3-yl)methyl 4-methoxybenzoate (CID 75399835) is (4-cyclopropyl-5-methyl-1,2,4-triazol-3-yl)methyl 4-methoxybenzoate.
What is the SMILES notation for (4-cyclopropyl-5-methyl-1,2,4-triazol-3-yl)methyl 4-methoxybenzoate?
The canonical SMILES for (4-cyclopropyl-5-methyl-1,2,4-triazol-3-yl)methyl 4-methoxybenzoate is COc1ccc(C(=O)OCc2nnc(C)n2C2CC2)cc1.
What is the InChIKey of (4-cyclopropyl-5-methyl-1,2,4-triazol-3-yl)methyl 4-methoxybenzoate?
The InChIKey is KGRYDINLYRAVFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17N3O3/c1-10-16-17-14(18(10)12-5-6-12)9-21-15(19)11-3-7-13(20-2)8-4-11/h3-4,7-8,12H,5-6,9H2,1-2H3.
What are the key properties of (4-cyclopropyl-5-methyl-1,2,4-triazol-3-yl)methyl 4-methoxybenzoate?
(4-cyclopropyl-5-methyl-1,2,4-triazol-3-yl)methyl 4-methoxybenzoate has a molecular weight of 287.32 g/mol, XLogP of 2.29, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (4-cyclopropyl-5-methyl-1,2,4-triazol-3-yl)methyl 4-methoxybenzoate is sourced from PubChem (CID 75399835), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).