About (4-cyclopropyl-5-methyl-1,2,4-triazol-3-yl)methyl 2-fluoro-4-methylbenzoate
(4-cyclopropyl-5-methyl-1,2,4-triazol-3-yl)methyl 2-fluoro-4-methylbenzoate (PubChem CID 75497271) has the molecular formula C15H16FN3O2
and a molecular weight of 289.31 g/mol. Its IUPAC name is (4-cyclopropyl-5-methyl-1,2,4-triazol-3-yl)methyl 2-fluoro-4-methylbenzoate.
Molecular Properties
| Compound Name | (4-cyclopropyl-5-methyl-1,2,4-triazol-3-yl)methyl 2-fluoro-4-methylbenzoate |
| PubChem CID | 75497271 |
| Molecular Formula | C15H16FN3O2 |
| Molecular Weight | 289.31 g/mol |
| Exact Mass | 289.12 |
| IUPAC Name | (4-cyclopropyl-5-methyl-1,2,4-triazol-3-yl)methyl 2-fluoro-4-methylbenzoate |
| SMILES | Cc1ccc(C(=O)OCc2nnc(C)n2C2CC2)c(F)c1 |
| InChI | InChI=1S/C15H16FN3O2/c1-9-3-6-12(13(16)7-9)15(20)21-8-14-18-17-10(2)19(14)11-4-5-11/h3,6-7,11H,4-5,8H2,1-2H3 |
| InChIKey | VVYXMFNOGGTFKU-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.31 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (4-cyclopropyl-5-methyl-1,2,4-triazol-3-yl)methyl 2-fluoro-4-methylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-cyclopropyl-5-methyl-1,2,4-triazol-3-yl)methyl 2-fluoro-4-methylbenzoate?
The IUPAC name of (4-cyclopropyl-5-methyl-1,2,4-triazol-3-yl)methyl 2-fluoro-4-methylbenzoate (CID 75497271) is (4-cyclopropyl-5-methyl-1,2,4-triazol-3-yl)methyl 2-fluoro-4-methylbenzoate.
What is the SMILES notation for (4-cyclopropyl-5-methyl-1,2,4-triazol-3-yl)methyl 2-fluoro-4-methylbenzoate?
The canonical SMILES for (4-cyclopropyl-5-methyl-1,2,4-triazol-3-yl)methyl 2-fluoro-4-methylbenzoate is Cc1ccc(C(=O)OCc2nnc(C)n2C2CC2)c(F)c1.
What is the InChIKey of (4-cyclopropyl-5-methyl-1,2,4-triazol-3-yl)methyl 2-fluoro-4-methylbenzoate?
The InChIKey is VVYXMFNOGGTFKU-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16FN3O2/c1-9-3-6-12(13(16)7-9)15(20)21-8-14-18-17-10(2)19(14)11-4-5-11/h3,6-7,11H,4-5,8H2,1-2H3.
What are the key properties of (4-cyclopropyl-5-methyl-1,2,4-triazol-3-yl)methyl 2-fluoro-4-methylbenzoate?
(4-cyclopropyl-5-methyl-1,2,4-triazol-3-yl)methyl 2-fluoro-4-methylbenzoate has a molecular weight of 289.31 g/mol, XLogP of 2.73, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4-cyclopropyl-5-methyl-1,2,4-triazol-3-yl)methyl 2-fluoro-4-methylbenzoate is sourced from PubChem (CID 75497271), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).