C12H12F2N4O2 — CID 104700500
(4,5-dimethyl-1,2,4-triazol-3-yl)methyl 4-amino-2,5-difluorobenzoate (PubChem CID 104700500) has the molecular formula C12H12F2N4O2 and a molecular weight of 282.25 g/mol. Its IUPAC name is (4,5-dimethyl-1,2,4-triazol-3-yl)methyl 4-amino-2,5-difluorobenzoate.
| Compound Name | (4,5-dimethyl-1,2,4-triazol-3-yl)methyl 4-amino-2,5-difluorobenzoate |
|---|---|
| PubChem CID | 104700500 |
| Molecular Formula | C12H12F2N4O2 |
| Molecular Weight | 282.25 g/mol |
| Exact Mass | 282.09 |
| IUPAC Name | (4,5-dimethyl-1,2,4-triazol-3-yl)methyl 4-amino-2,5-difluorobenzoate |
| SMILES | Cc1nnc(COC(=O)c2cc(F)c(N)cc2F)n1C |
| InChI | InChI=1S/C12H12F2N4O2/c1-6-16-17-11(18(6)2)5-20-12(19)7-3-9(14)10(15)4-8(7)13/h3-4H,5,15H2,1-2H3 |
| InChIKey | XSCZWYVUEXAQTP-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.25 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|