C13H14F2N4O2 — CID 104700514
(2-propan-2-yl-1,2,4-triazol-3-yl)methyl 4-amino-2,5-difluorobenzoate (PubChem CID 104700514) has the molecular formula C13H14F2N4O2 and a molecular weight of 296.28 g/mol. Its IUPAC name is (2-propan-2-yl-1,2,4-triazol-3-yl)methyl 4-amino-2,5-difluorobenzoate.
| Compound Name | (2-propan-2-yl-1,2,4-triazol-3-yl)methyl 4-amino-2,5-difluorobenzoate |
|---|---|
| PubChem CID | 104700514 |
| Molecular Formula | C13H14F2N4O2 |
| Molecular Weight | 296.28 g/mol |
| Exact Mass | 296.11 |
| IUPAC Name | (2-propan-2-yl-1,2,4-triazol-3-yl)methyl 4-amino-2,5-difluorobenzoate |
| SMILES | CC(C)n1ncnc1COC(=O)c1cc(F)c(N)cc1F |
| InChI | InChI=1S/C13H14F2N4O2/c1-7(2)19-12(17-6-18-19)5-21-13(20)8-3-10(15)11(16)4-9(8)14/h3-4,6-7H,5,16H2,1-2H3 |
| InChIKey | OFPLDEPCMYVBPG-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.28 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|