About (4-methoxyphenyl)methyl 4-(4-hydroxyphenyl)benzoate
(4-methoxyphenyl)methyl 4-(4-hydroxyphenyl)benzoate (PubChem CID 16577371) has the molecular formula C21H18O4
and a molecular weight of 334.37 g/mol. Its IUPAC name is (4-methoxyphenyl)methyl 4-(4-hydroxyphenyl)benzoate.
Molecular Properties
| Compound Name | (4-methoxyphenyl)methyl 4-(4-hydroxyphenyl)benzoate |
| PubChem CID | 16577371 |
| Molecular Formula | C21H18O4 |
| Molecular Weight | 334.37 g/mol |
| Exact Mass | 334.12 |
| IUPAC Name | (4-methoxyphenyl)methyl 4-(4-hydroxyphenyl)benzoate |
| SMILES | COc1ccc(COC(=O)c2ccc(-c3ccc(O)cc3)cc2)cc1 |
| InChI | InChI=1S/C21H18O4/c1-24-20-12-2-15(3-13-20)14-25-21(23)18-6-4-16(5-7-18)17-8-10-19(22)11-9-17/h2-13,22H,14H2,1H3 |
| InChIKey | JCMGISIPZVOTMG-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.37 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (4-methoxyphenyl)methyl 4-(4-hydroxyphenyl)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-methoxyphenyl)methyl 4-(4-hydroxyphenyl)benzoate?
The IUPAC name of (4-methoxyphenyl)methyl 4-(4-hydroxyphenyl)benzoate (CID 16577371) is (4-methoxyphenyl)methyl 4-(4-hydroxyphenyl)benzoate.
What is the SMILES notation for (4-methoxyphenyl)methyl 4-(4-hydroxyphenyl)benzoate?
The canonical SMILES for (4-methoxyphenyl)methyl 4-(4-hydroxyphenyl)benzoate is COc1ccc(COC(=O)c2ccc(-c3ccc(O)cc3)cc2)cc1.
What is the InChIKey of (4-methoxyphenyl)methyl 4-(4-hydroxyphenyl)benzoate?
The InChIKey is JCMGISIPZVOTMG-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H18O4/c1-24-20-12-2-15(3-13-20)14-25-21(23)18-6-4-16(5-7-18)17-8-10-19(22)11-9-17/h2-13,22H,14H2,1H3.
What are the key properties of (4-methoxyphenyl)methyl 4-(4-hydroxyphenyl)benzoate?
(4-methoxyphenyl)methyl 4-(4-hydroxyphenyl)benzoate has a molecular weight of 334.37 g/mol, XLogP of 4.42, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-methoxyphenyl)methyl 4-(4-hydroxyphenyl)benzoate is sourced from PubChem (CID 16577371), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).