About (4-hydroxyphenyl)methyl 4-prop-2-enoxybenzoate
(4-hydroxyphenyl)methyl 4-prop-2-enoxybenzoate (PubChem CID 175436244) has the molecular formula C17H16O4
and a molecular weight of 284.31 g/mol. Its IUPAC name is (4-hydroxyphenyl)methyl 4-prop-2-enoxybenzoate.
Molecular Properties
| Compound Name | (4-hydroxyphenyl)methyl 4-prop-2-enoxybenzoate |
| PubChem CID | 175436244 |
| Molecular Formula | C17H16O4 |
| Molecular Weight | 284.31 g/mol |
| Exact Mass | 284.10 |
| IUPAC Name | (4-hydroxyphenyl)methyl 4-prop-2-enoxybenzoate |
| SMILES | C=CCOc1ccc(C(=O)OCc2ccc(O)cc2)cc1 |
| InChI | InChI=1S/C17H16O4/c1-2-11-20-16-9-5-14(6-10-16)17(19)21-12-13-3-7-15(18)8-4-13/h2-10,18H,1,11-12H2 |
| InChIKey | LDTHOZNVQBYCGB-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.31 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (4-hydroxyphenyl)methyl 4-prop-2-enoxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-hydroxyphenyl)methyl 4-prop-2-enoxybenzoate?
The IUPAC name of (4-hydroxyphenyl)methyl 4-prop-2-enoxybenzoate (CID 175436244) is (4-hydroxyphenyl)methyl 4-prop-2-enoxybenzoate.
What is the SMILES notation for (4-hydroxyphenyl)methyl 4-prop-2-enoxybenzoate?
The canonical SMILES for (4-hydroxyphenyl)methyl 4-prop-2-enoxybenzoate is C=CCOc1ccc(C(=O)OCc2ccc(O)cc2)cc1.
What is the InChIKey of (4-hydroxyphenyl)methyl 4-prop-2-enoxybenzoate?
The InChIKey is LDTHOZNVQBYCGB-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16O4/c1-2-11-20-16-9-5-14(6-10-16)17(19)21-12-13-3-7-15(18)8-4-13/h2-10,18H,1,11-12H2.
What are the key properties of (4-hydroxyphenyl)methyl 4-prop-2-enoxybenzoate?
(4-hydroxyphenyl)methyl 4-prop-2-enoxybenzoate has a molecular weight of 284.31 g/mol, XLogP of 3.31, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-hydroxyphenyl)methyl 4-prop-2-enoxybenzoate is sourced from PubChem (CID 175436244), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).