C27H30BN3O5S2 — CID 123180820
CID 123180820 (PubChem CID 123180820) has the molecular formula C27H30BN3O5S2 and a molecular weight of 551.50 g/mol.
| Compound Name | CID 123180820 |
|---|---|
| PubChem CID | 123180820 |
| Molecular Formula | C27H30BN3O5S2 |
| Molecular Weight | 551.50 g/mol |
| Exact Mass | 551.17 |
| IUPAC Name | — |
| SMILES | [B]c1cc2c(c(CN3C=CC(C)CC=C3C)c1O)c(C(=O)OCC)c(CS(=O)(=O)c1nccs1)n2C1CC1 |
| InChI | InChI=1S/C27H30BN3O5S2/c1-4-36-26(33)24-22(15-38(34,35)27-29-10-12-37-27)31(18-7-8-18)21-13-20(28)25(32)19(23(21)24)14-30-11-9-16(2)5-6-17(30)3/h6,9-13,16,18,32H,4-5,7-8,14-15H2,1-3H3 |
| InChIKey | JDXRUKRWEWTWJC-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.50 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|