C27H25BrFN3O4S — CID 87872399
ethyl 6-bromo-1-cyclopropyl-2-[2-(2-fluorophenyl)-1-sulfinylethyl]-5-hydroxy-4-[(2-methylimidazol-1-yl)methyl]indole-3-carboxylate (PubChem CID 87872399) has the molecular formula C27H25BrFN3O4S and a molecular weight of 586.48 g/mol. Its IUPAC name is ethyl 6-bromo-1-cyclopropyl-2-[2-(2-fluorophenyl)-1-sulfinylethyl]-5-hydroxy-4-[(2-methylimidazol-1-yl)methyl]indole-3-carboxylate.
| Compound Name | ethyl 6-bromo-1-cyclopropyl-2-[2-(2-fluorophenyl)-1-sulfinylethyl]-5-hydroxy-4-[(2-methylimidazol-1-yl)methyl]indole-3-carboxylate |
|---|---|
| PubChem CID | 87872399 |
| Molecular Formula | C27H25BrFN3O4S |
| Molecular Weight | 586.48 g/mol |
| Exact Mass | 585.07 |
| IUPAC Name | ethyl 6-bromo-1-cyclopropyl-2-[2-(2-fluorophenyl)-1-sulfinylethyl]-5-hydroxy-4-[(2-methylimidazol-1-yl)methyl]indole-3-carboxylate |
| SMILES | CCOC(=O)c1c(C(Cc2ccccc2F)=S=O)n(C2CC2)c2cc(Br)c(O)c(Cn3ccnc3C)c12 |
| InChI | InChI=1S/C27H25BrFN3O4S/c1-3-36-27(34)24-23-18(14-31-11-10-30-15(31)2)26(33)19(28)13-21(23)32(17-8-9-17)25(24)22(37-35)12-16-6-4-5-7-20(16)29/h4-7,10-11,13,17,33H,3,8-9,12,14H2,1-2H3 |
| InChIKey | XNNAAHMOAZLUTL-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 86.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.48 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|