C26H32BrClN2O3S — CID 67241324
ethyl 6-bromo-1-cyclopropyl-4-[(dimethylamino)methyl]-5-hydroxy-2-(2-phenylethylsulfanylmethyl)indole-3-carboxylate;hydrochloride (PubChem CID 67241324) has the molecular formula C26H32BrClN2O3S and a molecular weight of 567.98 g/mol. Its IUPAC name is ethyl 6-bromo-1-cyclopropyl-4-[(dimethylamino)methyl]-5-hydroxy-2-(2-phenylethylsulfanylmethyl)indole-3-carboxylate;hydrochloride.
| Compound Name | ethyl 6-bromo-1-cyclopropyl-4-[(dimethylamino)methyl]-5-hydroxy-2-(2-phenylethylsulfanylmethyl)indole-3-carboxylate;hydrochloride |
|---|---|
| PubChem CID | 67241324 |
| Molecular Formula | C26H32BrClN2O3S |
| Molecular Weight | 567.98 g/mol |
| Exact Mass | 566.10 |
| IUPAC Name | ethyl 6-bromo-1-cyclopropyl-4-[(dimethylamino)methyl]-5-hydroxy-2-(2-phenylethylsulfanylmethyl)indole-3-carboxylate;hydrochloride |
| SMILES | CCOC(=O)c1c(CSCCc2ccccc2)n(C2CC2)c2cc(Br)c(O)c(CN(C)C)c12.Cl |
| InChI | InChI=1S/C26H31BrN2O3S.ClH/c1-4-32-26(31)24-22(16-33-13-12-17-8-6-5-7-9-17)29(18-10-11-18)21-14-20(27)25(30)19(23(21)24)15-28(2)3;/h5-9,14,18,30H,4,10-13,15-16H2,1-3H3;1H |
| InChIKey | ISFNISXTJODMPG-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.98 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|