C22H31ClN2O3 — CID 66895355
ethyl 6-chloro-1-cyclohexyl-4-[(dimethylamino)methyl]-2-ethyl-5-hydroxyindole-3-carboxylate (PubChem CID 66895355) has the molecular formula C22H31ClN2O3 and a molecular weight of 406.95 g/mol. Its IUPAC name is ethyl 6-chloro-1-cyclohexyl-4-[(dimethylamino)methyl]-2-ethyl-5-hydroxyindole-3-carboxylate.
| Compound Name | ethyl 6-chloro-1-cyclohexyl-4-[(dimethylamino)methyl]-2-ethyl-5-hydroxyindole-3-carboxylate |
|---|---|
| PubChem CID | 66895355 |
| Molecular Formula | C22H31ClN2O3 |
| Molecular Weight | 406.95 g/mol |
| Exact Mass | 406.20 |
| IUPAC Name | ethyl 6-chloro-1-cyclohexyl-4-[(dimethylamino)methyl]-2-ethyl-5-hydroxyindole-3-carboxylate |
| SMILES | CCOC(=O)c1c(CC)n(C2CCCCC2)c2cc(Cl)c(O)c(CN(C)C)c12 |
| InChI | InChI=1S/C22H31ClN2O3/c1-5-17-20(22(27)28-6-2)19-15(13-24(3)4)21(26)16(23)12-18(19)25(17)14-10-8-7-9-11-14/h12,14,26H,5-11,13H2,1-4H3 |
| InChIKey | ZIVZRNQZNHVVGT-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.95 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|