C38H56N6O6 — CID 162131276
ethyl 2,4-bis[(dimethylamino)methyl]-5-hydroxy-1,6-dimethylindole-3-carboxylate;ethyl 8-[(dimethylamino)methyl]-2,5,7-trimethyl-1,3-dihydropyrrolo[3,2-f][1,3]benzoxazine-9-carboxylate (PubChem CID 162131276) has the molecular formula C38H56N6O6 and a molecular weight of 692.90 g/mol. Its IUPAC name is ethyl 2,4-bis[(dimethylamino)methyl]-5-hydroxy-1,6-dimethylindole-3-carboxylate;ethyl 8-[(dimethylamino)methyl]-2,5,7-trimethyl-1,3-dihydropyrrolo[3,2-f][1,3]benzoxazine-9-carboxylate.
| Compound Name | ethyl 2,4-bis[(dimethylamino)methyl]-5-hydroxy-1,6-dimethylindole-3-carboxylate;ethyl 8-[(dimethylamino)methyl]-2,5,7-trimethyl-1,3-dihydropyrrolo[3,2-f][1,3]benzoxazine-9-carboxylate |
|---|---|
| PubChem CID | 162131276 |
| Molecular Formula | C38H56N6O6 |
| Molecular Weight | 692.90 g/mol |
| Exact Mass | 692.43 |
| IUPAC Name | ethyl 2,4-bis[(dimethylamino)methyl]-5-hydroxy-1,6-dimethylindole-3-carboxylate;ethyl 8-[(dimethylamino)methyl]-2,5,7-trimethyl-1,3-dihydropyrrolo[3,2-f][1,3]benzoxazine-9-carboxylate |
| SMILES | CCOC(=O)c1c(CN(C)C)n(C)c2cc(C)c(O)c(CN(C)C)c12.CCOC(=O)c1c(CN(C)C)n(C)c2cc(C)c3c(c12)CN(C)CO3 |
| InChI | InChI=1S/C19H27N3O3.C19H29N3O3/c1-7-24-19(23)17-15(10-20(3)4)22(6)14-8-12(2)18-13(16(14)17)9-21(5)11-25-18;1-8-25-19(24)17-15(11-21(5)6)22(7)14-9-12(2)18(23)13(16(14)17)10-20(3)4/h8H,7,9-11H2,1-6H3;9,23H,8,10-11H2,1-7H3 |
| InChIKey | ZIRTWGJCHJHFEH-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 104.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.90 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|