C23H28BrN3O3 — CID 143583147
ethyl 5-bromo-8-[[[(2E,4Z)-hepta-2,4,6-trien-2-yl]amino]methyl]-2,7-dimethyl-1,3-dihydropyrrolo[3,2-f][1,3]benzoxazine-9-carboxylate (PubChem CID 143583147) has the molecular formula C23H28BrN3O3 and a molecular weight of 474.40 g/mol. Its IUPAC name is ethyl 5-bromo-8-[[[(2E,4Z)-hepta-2,4,6-trien-2-yl]amino]methyl]-2,7-dimethyl-1,3-dihydropyrrolo[3,2-f][1,3]benzoxazine-9-carboxylate.
| Compound Name | ethyl 5-bromo-8-[[[(2E,4Z)-hepta-2,4,6-trien-2-yl]amino]methyl]-2,7-dimethyl-1,3-dihydropyrrolo[3,2-f][1,3]benzoxazine-9-carboxylate |
|---|---|
| PubChem CID | 143583147 |
| Molecular Formula | C23H28BrN3O3 |
| Molecular Weight | 474.40 g/mol |
| Exact Mass | 473.13 |
| IUPAC Name | ethyl 5-bromo-8-[[[(2E,4Z)-hepta-2,4,6-trien-2-yl]amino]methyl]-2,7-dimethyl-1,3-dihydropyrrolo[3,2-f][1,3]benzoxazine-9-carboxylate |
| SMILES | C=C/C=C\C=C(/C)NCc1c(C(=O)OCC)c2c3c(c(Br)cc2n1C)OCN(C)C3 |
| InChI | InChI=1S/C23H28BrN3O3/c1-6-8-9-10-15(3)25-12-19-21(23(28)29-7-2)20-16-13-26(4)14-30-22(16)17(24)11-18(20)27(19)5/h6,8-11,25H,1,7,12-14H2,2-5H3/b9-8-,15-10+ |
| InChIKey | DJBAWHBFKMIKMM-ABRUBGJPSA-N |
| XLogP | 4.63 |
| TPSA | 55.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.40 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|