C14H17N3O2 — CID 155200987
ethyl 2-[[(2E,4Z)-hepta-2,4,6-trien-2-yl]amino]pyrimidine-5-carboxylate (PubChem CID 155200987) has the molecular formula C14H17N3O2 and a molecular weight of 259.31 g/mol. Its IUPAC name is ethyl 2-[[(2E,4Z)-hepta-2,4,6-trien-2-yl]amino]pyrimidine-5-carboxylate.
| Compound Name | ethyl 2-[[(2E,4Z)-hepta-2,4,6-trien-2-yl]amino]pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 155200987 |
| Molecular Formula | C14H17N3O2 |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.13 |
| IUPAC Name | ethyl 2-[[(2E,4Z)-hepta-2,4,6-trien-2-yl]amino]pyrimidine-5-carboxylate |
| SMILES | C=C/C=C\C=C(/C)Nc1ncc(C(=O)OCC)cn1 |
| InChI | InChI=1S/C14H17N3O2/c1-4-6-7-8-11(3)17-14-15-9-12(10-16-14)13(18)19-5-2/h4,6-10H,1,5H2,2-3H3,(H,15,16,17)/b7-6-,11-8+ |
| InChIKey | PVIOSXLRWFSQGV-BQGCWICQSA-N |
| XLogP | 2.71 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|