C20H17N3O2 — CID 67679226
ethyl 2-(9H-fluoren-9-ylamino)pyrimidine-5-carboxylate (PubChem CID 67679226) has the molecular formula C20H17N3O2 and a molecular weight of 331.38 g/mol. Its IUPAC name is ethyl 2-(9H-fluoren-9-ylamino)pyrimidine-5-carboxylate.
| Compound Name | ethyl 2-(9H-fluoren-9-ylamino)pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 67679226 |
| Molecular Formula | C20H17N3O2 |
| Molecular Weight | 331.38 g/mol |
| Exact Mass | 331.13 |
| IUPAC Name | ethyl 2-(9H-fluoren-9-ylamino)pyrimidine-5-carboxylate |
| SMILES | CCOC(=O)c1cnc(NC2c3ccccc3-c3ccccc32)nc1 |
| InChI | InChI=1S/C20H17N3O2/c1-2-25-19(24)13-11-21-20(22-12-13)23-18-16-9-5-3-7-14(16)15-8-4-6-10-17(15)18/h3-12,18H,2H2,1H3,(H,21,22,23) |
| InChIKey | DSAHBOMIXOMDPC-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.38 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |