C21H18N2O2 — CID 157435209
ethyl 2-(9H-fluoren-9-ylmethyl)pyrimidine-5-carboxylate (PubChem CID 157435209) has the molecular formula C21H18N2O2 and a molecular weight of 330.39 g/mol. Its IUPAC name is ethyl 2-(9H-fluoren-9-ylmethyl)pyrimidine-5-carboxylate.
| Compound Name | ethyl 2-(9H-fluoren-9-ylmethyl)pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 157435209 |
| Molecular Formula | C21H18N2O2 |
| Molecular Weight | 330.39 g/mol |
| Exact Mass | 330.14 |
| IUPAC Name | ethyl 2-(9H-fluoren-9-ylmethyl)pyrimidine-5-carboxylate |
| SMILES | CCOC(=O)c1cnc(CC2c3ccccc3-c3ccccc32)nc1 |
| InChI | InChI=1S/C21H18N2O2/c1-2-25-21(24)14-12-22-20(23-13-14)11-19-17-9-5-3-7-15(17)16-8-4-6-10-18(16)19/h3-10,12-13,19H,2,11H2,1H3 |
| InChIKey | ABKGVUZEDZDFJL-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.39 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |