C17H18N2O2 — CID 159864160
ethyl 2-[(1-phenylcyclopropyl)methyl]pyrimidine-5-carboxylate (PubChem CID 159864160) has the molecular formula C17H18N2O2 and a molecular weight of 282.34 g/mol. Its IUPAC name is ethyl 2-[(1-phenylcyclopropyl)methyl]pyrimidine-5-carboxylate.
| Compound Name | ethyl 2-[(1-phenylcyclopropyl)methyl]pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 159864160 |
| Molecular Formula | C17H18N2O2 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.14 |
| IUPAC Name | ethyl 2-[(1-phenylcyclopropyl)methyl]pyrimidine-5-carboxylate |
| SMILES | CCOC(=O)c1cnc(CC2(c3ccccc3)CC2)nc1 |
| InChI | InChI=1S/C17H18N2O2/c1-2-21-16(20)13-11-18-15(19-12-13)10-17(8-9-17)14-6-4-3-5-7-14/h3-7,11-12H,2,8-10H2,1H3 |
| InChIKey | FATHONNYUQQYRV-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |