C23H24BrN3O4 — CID 50742610
ethyl 6-bromo-2-[(4-cyanophenoxy)methyl]-4-[(dimethylamino)methyl]-5-hydroxy-1-methylindole-3-carboxylate (PubChem CID 50742610) has the molecular formula C23H24BrN3O4 and a molecular weight of 486.37 g/mol. Its IUPAC name is ethyl 6-bromo-2-[(4-cyanophenoxy)methyl]-4-[(dimethylamino)methyl]-5-hydroxy-1-methylindole-3-carboxylate.
| Compound Name | ethyl 6-bromo-2-[(4-cyanophenoxy)methyl]-4-[(dimethylamino)methyl]-5-hydroxy-1-methylindole-3-carboxylate |
|---|---|
| PubChem CID | 50742610 |
| Molecular Formula | C23H24BrN3O4 |
| Molecular Weight | 486.37 g/mol |
| Exact Mass | 485.10 |
| IUPAC Name | ethyl 6-bromo-2-[(4-cyanophenoxy)methyl]-4-[(dimethylamino)methyl]-5-hydroxy-1-methylindole-3-carboxylate |
| SMILES | CCOC(=O)c1c(COc2ccc(C#N)cc2)n(C)c2cc(Br)c(O)c(CN(C)C)c12 |
| InChI | InChI=1S/C23H24BrN3O4/c1-5-30-23(29)21-19(13-31-15-8-6-14(11-25)7-9-15)27(4)18-10-17(24)22(28)16(20(18)21)12-26(2)3/h6-10,28H,5,12-13H2,1-4H3 |
| InChIKey | ZKBHIFHEYMSSOW-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 87.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.37 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|