C27H35BrN2O3S — CID 87322103
ethyl 6-bromo-4-[(dimethylamino)methyl]-5-hydroxy-1-propan-2-yl-2-[(4-propan-2-ylphenyl)-sulfanylmethyl]indole-3-carboxylate (PubChem CID 87322103) has the molecular formula C27H35BrN2O3S and a molecular weight of 547.56 g/mol. Its IUPAC name is ethyl 6-bromo-4-[(dimethylamino)methyl]-5-hydroxy-1-propan-2-yl-2-[(4-propan-2-ylphenyl)-sulfanylmethyl]indole-3-carboxylate.
| Compound Name | ethyl 6-bromo-4-[(dimethylamino)methyl]-5-hydroxy-1-propan-2-yl-2-[(4-propan-2-ylphenyl)-sulfanylmethyl]indole-3-carboxylate |
|---|---|
| PubChem CID | 87322103 |
| Molecular Formula | C27H35BrN2O3S |
| Molecular Weight | 547.56 g/mol |
| Exact Mass | 546.16 |
| IUPAC Name | ethyl 6-bromo-4-[(dimethylamino)methyl]-5-hydroxy-1-propan-2-yl-2-[(4-propan-2-ylphenyl)-sulfanylmethyl]indole-3-carboxylate |
| SMILES | CCOC(=O)c1c(C(S)c2ccc(C(C)C)cc2)n(C(C)C)c2cc(Br)c(O)c(CN(C)C)c12 |
| InChI | InChI=1S/C27H35BrN2O3S/c1-8-33-27(32)23-22-19(14-29(6)7)25(31)20(28)13-21(22)30(16(4)5)24(23)26(34)18-11-9-17(10-12-18)15(2)3/h9-13,15-16,26,31,34H,8,14H2,1-7H3 |
| InChIKey | SKMRQCBOEVTSIZ-UHFFFAOYSA-N |
| XLogP | 7.07 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.56 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|