C24H29BrN2O4S — CID 87321590
ethyl 6-bromo-4-[(dimethylamino)methyl]-5-hydroxy-1-methyl-2-(3-phenoxy-1-sulfanylpropyl)indole-3-carboxylate (PubChem CID 87321590) has the molecular formula C24H29BrN2O4S and a molecular weight of 521.48 g/mol. Its IUPAC name is ethyl 6-bromo-4-[(dimethylamino)methyl]-5-hydroxy-1-methyl-2-(3-phenoxy-1-sulfanylpropyl)indole-3-carboxylate.
| Compound Name | ethyl 6-bromo-4-[(dimethylamino)methyl]-5-hydroxy-1-methyl-2-(3-phenoxy-1-sulfanylpropyl)indole-3-carboxylate |
|---|---|
| PubChem CID | 87321590 |
| Molecular Formula | C24H29BrN2O4S |
| Molecular Weight | 521.48 g/mol |
| Exact Mass | 520.10 |
| IUPAC Name | ethyl 6-bromo-4-[(dimethylamino)methyl]-5-hydroxy-1-methyl-2-(3-phenoxy-1-sulfanylpropyl)indole-3-carboxylate |
| SMILES | CCOC(=O)c1c(C(S)CCOc2ccccc2)n(C)c2cc(Br)c(O)c(CN(C)C)c12 |
| InChI | InChI=1S/C24H29BrN2O4S/c1-5-30-24(29)21-20-16(14-26(2)3)23(28)17(25)13-18(20)27(4)22(21)19(32)11-12-31-15-9-7-6-8-10-15/h6-10,13,19,28,32H,5,11-12,14H2,1-4H3 |
| InChIKey | BCVKWYUUJHWRJU-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 63.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.48 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|