C32H36N2O4S — CID 143583168
ethyl 4-[(dimethylamino)methyl]-5-hydroxy-1-methyl-6-[(Z)-1-(2-methylphenoxy)prop-1-enyl]-2-(phenylsulfanylmethyl)indole-3-carboxylate (PubChem CID 143583168) has the molecular formula C32H36N2O4S and a molecular weight of 544.72 g/mol. Its IUPAC name is ethyl 4-[(dimethylamino)methyl]-5-hydroxy-1-methyl-6-[(Z)-1-(2-methylphenoxy)prop-1-enyl]-2-(phenylsulfanylmethyl)indole-3-carboxylate.
| Compound Name | ethyl 4-[(dimethylamino)methyl]-5-hydroxy-1-methyl-6-[(Z)-1-(2-methylphenoxy)prop-1-enyl]-2-(phenylsulfanylmethyl)indole-3-carboxylate |
|---|---|
| PubChem CID | 143583168 |
| Molecular Formula | C32H36N2O4S |
| Molecular Weight | 544.72 g/mol |
| Exact Mass | 544.24 |
| IUPAC Name | ethyl 4-[(dimethylamino)methyl]-5-hydroxy-1-methyl-6-[(Z)-1-(2-methylphenoxy)prop-1-enyl]-2-(phenylsulfanylmethyl)indole-3-carboxylate |
| SMILES | C/C=C(\Oc1ccccc1C)c1cc2c(c(CN(C)C)c1O)c(C(=O)OCC)c(CSc1ccccc1)n2C |
| InChI | InChI=1S/C32H36N2O4S/c1-7-27(38-28-17-13-12-14-21(28)3)23-18-25-29(24(31(23)35)19-33(4)5)30(32(36)37-8-2)26(34(25)6)20-39-22-15-10-9-11-16-22/h7,9-18,35H,8,19-20H2,1-6H3/b27-7- |
| InChIKey | WEOWFJCCXMGYGN-FEDGQQDLSA-N |
| XLogP | 7.16 |
| TPSA | 63.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.72 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|