C19H18BrNO3S — CID 150309043
ethyl 4-bromo-5-hydroxy-1-methyl-2-(phenylsulfanylmethyl)indole-3-carboxylate (PubChem CID 150309043) has the molecular formula C19H18BrNO3S and a molecular weight of 420.33 g/mol. Its IUPAC name is ethyl 4-bromo-5-hydroxy-1-methyl-2-(phenylsulfanylmethyl)indole-3-carboxylate.
| Compound Name | ethyl 4-bromo-5-hydroxy-1-methyl-2-(phenylsulfanylmethyl)indole-3-carboxylate |
|---|---|
| PubChem CID | 150309043 |
| Molecular Formula | C19H18BrNO3S |
| Molecular Weight | 420.33 g/mol |
| Exact Mass | 419.02 |
| IUPAC Name | ethyl 4-bromo-5-hydroxy-1-methyl-2-(phenylsulfanylmethyl)indole-3-carboxylate |
| SMILES | CCOC(=O)c1c(CSc2ccccc2)n(C)c2ccc(O)c(Br)c12 |
| InChI | InChI=1S/C19H18BrNO3S/c1-3-24-19(23)17-14(11-25-12-7-5-4-6-8-12)21(2)13-9-10-15(22)18(20)16(13)17/h4-10,22H,3,11H2,1-2H3 |
| InChIKey | GLFKHRMXAWISAU-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 51.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.33 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |