C22H28BrN2O7PS — CID 11613939
ethyl 6-bromo-4-[(dimethylamino)methyl]-5-hydroxy-1-methyl-2-(phenylsulfanylmethyl)indole-3-carboxylate;phosphoric acid (PubChem CID 11613939) has the molecular formula C22H28BrN2O7PS and a molecular weight of 575.42 g/mol. Its IUPAC name is ethyl 6-bromo-4-[(dimethylamino)methyl]-5-hydroxy-1-methyl-2-(phenylsulfanylmethyl)indole-3-carboxylate;phosphoric acid.
| Compound Name | ethyl 6-bromo-4-[(dimethylamino)methyl]-5-hydroxy-1-methyl-2-(phenylsulfanylmethyl)indole-3-carboxylate;phosphoric acid |
|---|---|
| PubChem CID | 11613939 |
| Molecular Formula | C22H28BrN2O7PS |
| Molecular Weight | 575.42 g/mol |
| Exact Mass | 574.05 |
| IUPAC Name | ethyl 6-bromo-4-[(dimethylamino)methyl]-5-hydroxy-1-methyl-2-(phenylsulfanylmethyl)indole-3-carboxylate;phosphoric acid |
| SMILES | CCOC(=O)c1c(CSc2ccccc2)n(C)c2cc(Br)c(O)c(CN(C)C)c12.O=P(O)(O)O |
| InChI | InChI=1S/C22H25BrN2O3S.H3O4P/c1-5-28-22(27)20-18(13-29-14-9-7-6-8-10-14)25(4)17-11-16(23)21(26)15(19(17)20)12-24(2)3;1-5(2,3)4/h6-11,26H,5,12-13H2,1-4H3;(H3,1,2,3,4) |
| InChIKey | WIVRVUWTLLCBLM-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 132.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.42 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|