C30H41BrN2O3S — CID 87321559
ethyl 6-bromo-5-hydroxy-1-methyl-4-[[methyl(octyl)amino]methyl]-2-[(3-methylphenyl)-sulfanylmethyl]indole-3-carboxylate (PubChem CID 87321559) has the molecular formula C30H41BrN2O3S and a molecular weight of 589.64 g/mol. Its IUPAC name is ethyl 6-bromo-5-hydroxy-1-methyl-4-[[methyl(octyl)amino]methyl]-2-[(3-methylphenyl)-sulfanylmethyl]indole-3-carboxylate.
| Compound Name | ethyl 6-bromo-5-hydroxy-1-methyl-4-[[methyl(octyl)amino]methyl]-2-[(3-methylphenyl)-sulfanylmethyl]indole-3-carboxylate |
|---|---|
| PubChem CID | 87321559 |
| Molecular Formula | C30H41BrN2O3S |
| Molecular Weight | 589.64 g/mol |
| Exact Mass | 588.20 |
| IUPAC Name | ethyl 6-bromo-5-hydroxy-1-methyl-4-[[methyl(octyl)amino]methyl]-2-[(3-methylphenyl)-sulfanylmethyl]indole-3-carboxylate |
| SMILES | CCCCCCCCN(C)Cc1c(O)c(Br)cc2c1c(C(=O)OCC)c(C(S)c1cccc(C)c1)n2C |
| InChI | InChI=1S/C30H41BrN2O3S/c1-6-8-9-10-11-12-16-32(4)19-22-25-24(18-23(31)28(22)34)33(5)27(26(25)30(35)36-7-2)29(37)21-15-13-14-20(3)17-21/h13-15,17-18,29,34,37H,6-12,16,19H2,1-5H3 |
| InChIKey | JGPIJMRBUVMDPF-UHFFFAOYSA-N |
| XLogP | 7.94 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.64 |
| LogP ≤ 5 | 7.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|