C18H29Cl2N3O3 — CID 13181226
ethyl 4,6-bis[(dimethylamino)methyl]-5-hydroxy-2-methyl-1H-indole-3-carboxylate;dihydrochloride (PubChem CID 13181226) has the molecular formula C18H29Cl2N3O3 and a molecular weight of 406.35 g/mol. Its IUPAC name is ethyl 4,6-bis[(dimethylamino)methyl]-5-hydroxy-2-methyl-1H-indole-3-carboxylate;dihydrochloride.
| Compound Name | ethyl 4,6-bis[(dimethylamino)methyl]-5-hydroxy-2-methyl-1H-indole-3-carboxylate;dihydrochloride |
|---|---|
| PubChem CID | 13181226 |
| Molecular Formula | C18H29Cl2N3O3 |
| Molecular Weight | 406.35 g/mol |
| Exact Mass | 405.16 |
| IUPAC Name | ethyl 4,6-bis[(dimethylamino)methyl]-5-hydroxy-2-methyl-1H-indole-3-carboxylate;dihydrochloride |
| SMILES | CCOC(=O)c1c(C)[nH]c2cc(CN(C)C)c(O)c(CN(C)C)c12.Cl.Cl |
| InChI | InChI=1S/C18H27N3O3.2ClH/c1-7-24-18(23)15-11(2)19-14-8-12(9-20(3)4)17(22)13(16(14)15)10-21(5)6;;/h8,19,22H,7,9-10H2,1-6H3;2*1H |
| InChIKey | YYTPRSSOEDXPAP-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 68.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.35 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|