C20H21FN2O3 — CID 54079579
(4-fluorophenyl)methyl 4-[(dimethylamino)methyl]-5-hydroxy-2-methyl-1H-indole-3-carboxylate (PubChem CID 54079579) has the molecular formula C20H21FN2O3 and a molecular weight of 356.40 g/mol. Its IUPAC name is (4-fluorophenyl)methyl 4-[(dimethylamino)methyl]-5-hydroxy-2-methyl-1H-indole-3-carboxylate.
| Compound Name | (4-fluorophenyl)methyl 4-[(dimethylamino)methyl]-5-hydroxy-2-methyl-1H-indole-3-carboxylate |
|---|---|
| PubChem CID | 54079579 |
| Molecular Formula | C20H21FN2O3 |
| Molecular Weight | 356.40 g/mol |
| Exact Mass | 356.15 |
| IUPAC Name | (4-fluorophenyl)methyl 4-[(dimethylamino)methyl]-5-hydroxy-2-methyl-1H-indole-3-carboxylate |
| SMILES | Cc1[nH]c2ccc(O)c(CN(C)C)c2c1C(=O)OCc1ccc(F)cc1 |
| InChI | InChI=1S/C20H21FN2O3/c1-12-18(20(25)26-11-13-4-6-14(21)7-5-13)19-15(10-23(2)3)17(24)9-8-16(19)22-12/h4-9,22,24H,10-11H2,1-3H3 |
| InChIKey | MMDIPIIUCZVWMS-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 65.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.40 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|