C15H21ClN2O3 — CID 134108985
ethyl 6-[(dimethylamino)methyl]-5-hydroxy-2-methyl-1H-indole-3-carboxylate;hydrochloride (PubChem CID 134108985) has the molecular formula C15H21ClN2O3 and a molecular weight of 312.80 g/mol. Its IUPAC name is ethyl 6-[(dimethylamino)methyl]-5-hydroxy-2-methyl-1H-indole-3-carboxylate;hydrochloride.
| Compound Name | ethyl 6-[(dimethylamino)methyl]-5-hydroxy-2-methyl-1H-indole-3-carboxylate;hydrochloride |
|---|---|
| PubChem CID | 134108985 |
| Molecular Formula | C15H21ClN2O3 |
| Molecular Weight | 312.80 g/mol |
| Exact Mass | 312.12 |
| IUPAC Name | ethyl 6-[(dimethylamino)methyl]-5-hydroxy-2-methyl-1H-indole-3-carboxylate;hydrochloride |
| SMILES | CCOC(=O)c1c(C)[nH]c2cc(CN(C)C)c(O)cc12.Cl |
| InChI | InChI=1S/C15H20N2O3.ClH/c1-5-20-15(19)14-9(2)16-12-6-10(8-17(3)4)13(18)7-11(12)14;/h6-7,16,18H,5,8H2,1-4H3;1H |
| InChIKey | FTQJJCFVVZZZPC-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 65.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.80 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|