C10H18ClN3O2 — CID 166516952
ethyl 3-amino-4-[(dimethylamino)methyl]-1H-pyrrole-2-carboxylate;hydrochloride (PubChem CID 166516952) has the molecular formula C10H18ClN3O2 and a molecular weight of 247.73 g/mol. Its IUPAC name is ethyl 3-amino-4-[(dimethylamino)methyl]-1H-pyrrole-2-carboxylate;hydrochloride.
| Compound Name | ethyl 3-amino-4-[(dimethylamino)methyl]-1H-pyrrole-2-carboxylate;hydrochloride |
|---|---|
| PubChem CID | 166516952 |
| Molecular Formula | C10H18ClN3O2 |
| Molecular Weight | 247.73 g/mol |
| Exact Mass | 247.11 |
| IUPAC Name | ethyl 3-amino-4-[(dimethylamino)methyl]-1H-pyrrole-2-carboxylate;hydrochloride |
| SMILES | CCOC(=O)c1[nH]cc(CN(C)C)c1N.Cl |
| InChI | InChI=1S/C10H17N3O2.ClH/c1-4-15-10(14)9-8(11)7(5-12-9)6-13(2)3;/h5,12H,4,6,11H2,1-3H3;1H |
| InChIKey | DCGRQZPHJQGBSU-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 71.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.73 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |