C20H27N3O4 — CID 10248770
ethyl 2,6-dimethyl-5-[2-(4-methylpiperazin-1-yl)acetyl]oxy-1H-indole-3-carboxylate (PubChem CID 10248770) has the molecular formula C20H27N3O4 and a molecular weight of 373.45 g/mol. Its IUPAC name is ethyl 2,6-dimethyl-5-[2-(4-methylpiperazin-1-yl)acetyl]oxy-1H-indole-3-carboxylate.
| Compound Name | ethyl 2,6-dimethyl-5-[2-(4-methylpiperazin-1-yl)acetyl]oxy-1H-indole-3-carboxylate |
|---|---|
| PubChem CID | 10248770 |
| Molecular Formula | C20H27N3O4 |
| Molecular Weight | 373.45 g/mol |
| Exact Mass | 373.20 |
| IUPAC Name | ethyl 2,6-dimethyl-5-[2-(4-methylpiperazin-1-yl)acetyl]oxy-1H-indole-3-carboxylate |
| SMILES | CCOC(=O)c1c(C)[nH]c2cc(C)c(OC(=O)CN3CCN(C)CC3)cc12 |
| InChI | InChI=1S/C20H27N3O4/c1-5-26-20(25)19-14(3)21-16-10-13(2)17(11-15(16)19)27-18(24)12-23-8-6-22(4)7-9-23/h10-11,21H,5-9,12H2,1-4H3 |
| InChIKey | OOZKMDGSWMKBMW-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 74.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.45 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|