C15H23N3O3S — CID 22197629
ethyl 5-methyl-2-[[2-(4-methylpiperazin-1-yl)acetyl]amino]thiophene-3-carboxylate (PubChem CID 22197629) has the molecular formula C15H23N3O3S and a molecular weight of 325.43 g/mol. Its IUPAC name is ethyl 5-methyl-2-[[2-(4-methylpiperazin-1-yl)acetyl]amino]thiophene-3-carboxylate.
| Compound Name | ethyl 5-methyl-2-[[2-(4-methylpiperazin-1-yl)acetyl]amino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 22197629 |
| Molecular Formula | C15H23N3O3S |
| Molecular Weight | 325.43 g/mol |
| Exact Mass | 325.15 |
| IUPAC Name | ethyl 5-methyl-2-[[2-(4-methylpiperazin-1-yl)acetyl]amino]thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1cc(C)sc1NC(=O)CN1CCN(C)CC1 |
| InChI | InChI=1S/C15H23N3O3S/c1-4-21-15(20)12-9-11(2)22-14(12)16-13(19)10-18-7-5-17(3)6-8-18/h9H,4-8,10H2,1-3H3,(H,16,19) |
| InChIKey | YFMXKRINYBTMBK-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.43 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |