C13H16N4O3S — CID 63618199
ethyl 2-[[2-(3-aminopyrazol-1-yl)acetyl]amino]-5-methylthiophene-3-carboxylate (PubChem CID 63618199) has the molecular formula C13H16N4O3S and a molecular weight of 308.36 g/mol. Its IUPAC name is ethyl 2-[[2-(3-aminopyrazol-1-yl)acetyl]amino]-5-methylthiophene-3-carboxylate.
| Compound Name | ethyl 2-[[2-(3-aminopyrazol-1-yl)acetyl]amino]-5-methylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 63618199 |
| Molecular Formula | C13H16N4O3S |
| Molecular Weight | 308.36 g/mol |
| Exact Mass | 308.09 |
| IUPAC Name | ethyl 2-[[2-(3-aminopyrazol-1-yl)acetyl]amino]-5-methylthiophene-3-carboxylate |
| SMILES | CCOC(=O)c1cc(C)sc1NC(=O)Cn1ccc(N)n1 |
| InChI | InChI=1S/C13H16N4O3S/c1-3-20-13(19)9-6-8(2)21-12(9)15-11(18)7-17-5-4-10(14)16-17/h4-6H,3,7H2,1-2H3,(H2,14,16)(H,15,18) |
| InChIKey | RBJIQIZFCMMNMW-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 99.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.36 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |