C14H17N3O3S2 — CID 6469549
ethyl 5-methyl-2-[[2-(1-methylimidazol-2-yl)sulfanylacetyl]amino]thiophene-3-carboxylate (PubChem CID 6469549) has the molecular formula C14H17N3O3S2 and a molecular weight of 339.44 g/mol. Its IUPAC name is ethyl 5-methyl-2-[[2-(1-methylimidazol-2-yl)sulfanylacetyl]amino]thiophene-3-carboxylate.
| Compound Name | ethyl 5-methyl-2-[[2-(1-methylimidazol-2-yl)sulfanylacetyl]amino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 6469549 |
| Molecular Formula | C14H17N3O3S2 |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.07 |
| IUPAC Name | ethyl 5-methyl-2-[[2-(1-methylimidazol-2-yl)sulfanylacetyl]amino]thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1cc(C)sc1NC(=O)CSc1nccn1C |
| InChI | InChI=1S/C14H17N3O3S2/c1-4-20-13(19)10-7-9(2)22-12(10)16-11(18)8-21-14-15-5-6-17(14)3/h5-7H,4,8H2,1-3H3,(H,16,18) |
| InChIKey | ZVYKTPDIBWJCHR-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |