C15H16N2O3S2 — CID 6467819
ethyl 5-methyl-2-[(2-pyridin-2-ylsulfanylacetyl)amino]thiophene-3-carboxylate (PubChem CID 6467819) has the molecular formula C15H16N2O3S2 and a molecular weight of 336.44 g/mol. Its IUPAC name is ethyl 5-methyl-2-[(2-pyridin-2-ylsulfanylacetyl)amino]thiophene-3-carboxylate.
| Compound Name | ethyl 5-methyl-2-[(2-pyridin-2-ylsulfanylacetyl)amino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 6467819 |
| Molecular Formula | C15H16N2O3S2 |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.06 |
| IUPAC Name | ethyl 5-methyl-2-[(2-pyridin-2-ylsulfanylacetyl)amino]thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1cc(C)sc1NC(=O)CSc1ccccn1 |
| InChI | InChI=1S/C15H16N2O3S2/c1-3-20-15(19)11-8-10(2)22-14(11)17-12(18)9-21-13-6-4-5-7-16-13/h4-8H,3,9H2,1-2H3,(H,17,18) |
| InChIKey | PBFJJVNCIBJRNT-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |