C21H27N3O3S2 — CID 27999828
ethyl 5,5,7,7-tetramethyl-2-[(2-pyridin-2-ylsulfanylacetyl)amino]-4,6-dihydrothieno[2,3-c]pyridine-3-carboxylate (PubChem CID 27999828) has the molecular formula C21H27N3O3S2 and a molecular weight of 433.60 g/mol. Its IUPAC name is ethyl 5,5,7,7-tetramethyl-2-[(2-pyridin-2-ylsulfanylacetyl)amino]-4,6-dihydrothieno[2,3-c]pyridine-3-carboxylate.
| Compound Name | ethyl 5,5,7,7-tetramethyl-2-[(2-pyridin-2-ylsulfanylacetyl)amino]-4,6-dihydrothieno[2,3-c]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 27999828 |
| Molecular Formula | C21H27N3O3S2 |
| Molecular Weight | 433.60 g/mol |
| Exact Mass | 433.15 |
| IUPAC Name | ethyl 5,5,7,7-tetramethyl-2-[(2-pyridin-2-ylsulfanylacetyl)amino]-4,6-dihydrothieno[2,3-c]pyridine-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)CSc2ccccn2)sc2c1CC(C)(C)NC2(C)C |
| InChI | InChI=1S/C21H27N3O3S2/c1-6-27-19(26)16-13-11-20(2,3)24-21(4,5)17(13)29-18(16)23-14(25)12-28-15-9-7-8-10-22-15/h7-10,24H,6,11-12H2,1-5H3,(H,23,25) |
| InChIKey | KCLKWKOTKHIJHL-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.60 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |