C23H28ClN3O5S — CID 42988042
ethyl 2-[[2-(2-carbamoyl-4-chlorophenoxy)acetyl]amino]-5,5,7,7-tetramethyl-4,6-dihydrothieno[2,3-c]pyridine-3-carboxylate (PubChem CID 42988042) has the molecular formula C23H28ClN3O5S and a molecular weight of 494.01 g/mol. Its IUPAC name is ethyl 2-[[2-(2-carbamoyl-4-chlorophenoxy)acetyl]amino]-5,5,7,7-tetramethyl-4,6-dihydrothieno[2,3-c]pyridine-3-carboxylate.
| Compound Name | ethyl 2-[[2-(2-carbamoyl-4-chlorophenoxy)acetyl]amino]-5,5,7,7-tetramethyl-4,6-dihydrothieno[2,3-c]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 42988042 |
| Molecular Formula | C23H28ClN3O5S |
| Molecular Weight | 494.01 g/mol |
| Exact Mass | 493.14 |
| IUPAC Name | ethyl 2-[[2-(2-carbamoyl-4-chlorophenoxy)acetyl]amino]-5,5,7,7-tetramethyl-4,6-dihydrothieno[2,3-c]pyridine-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)COc2ccc(Cl)cc2C(N)=O)sc2c1CC(C)(C)NC2(C)C |
| InChI | InChI=1S/C23H28ClN3O5S/c1-6-31-21(30)17-14-10-22(2,3)27-23(4,5)18(14)33-20(17)26-16(28)11-32-15-8-7-12(24)9-13(15)19(25)29/h7-9,27H,6,10-11H2,1-5H3,(H2,25,29)(H,26,28) |
| InChIKey | SOTSEHRQGIQBKH-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 119.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.01 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |