C25H34N2O5S — CID 43952470
ethyl 2-[(3,4-diethoxybenzoyl)amino]-5,5,7,7-tetramethyl-4,6-dihydrothieno[2,3-c]pyridine-3-carboxylate (PubChem CID 43952470) has the molecular formula C25H34N2O5S and a molecular weight of 474.62 g/mol. Its IUPAC name is ethyl 2-[(3,4-diethoxybenzoyl)amino]-5,5,7,7-tetramethyl-4,6-dihydrothieno[2,3-c]pyridine-3-carboxylate.
| Compound Name | ethyl 2-[(3,4-diethoxybenzoyl)amino]-5,5,7,7-tetramethyl-4,6-dihydrothieno[2,3-c]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 43952470 |
| Molecular Formula | C25H34N2O5S |
| Molecular Weight | 474.62 g/mol |
| Exact Mass | 474.22 |
| IUPAC Name | ethyl 2-[(3,4-diethoxybenzoyl)amino]-5,5,7,7-tetramethyl-4,6-dihydrothieno[2,3-c]pyridine-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)c2ccc(OCC)c(OCC)c2)sc2c1CC(C)(C)NC2(C)C |
| InChI | InChI=1S/C25H34N2O5S/c1-8-30-17-12-11-15(13-18(17)31-9-2)21(28)26-22-19(23(29)32-10-3)16-14-24(4,5)27-25(6,7)20(16)33-22/h11-13,27H,8-10,14H2,1-7H3,(H,26,28) |
| InChIKey | KFDIGCJCNCGPNN-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.62 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |