C27H40ClN3O5S2 — CID 18558643
ethyl 2-[[4-(dipropylsulfamoyl)benzoyl]amino]-5,5,7,7-tetramethyl-4,6-dihydrothieno[2,3-c]pyridine-3-carboxylate;hydrochloride (PubChem CID 18558643) has the molecular formula C27H40ClN3O5S2 and a molecular weight of 586.22 g/mol. Its IUPAC name is ethyl 2-[[4-(dipropylsulfamoyl)benzoyl]amino]-5,5,7,7-tetramethyl-4,6-dihydrothieno[2,3-c]pyridine-3-carboxylate;hydrochloride.
| Compound Name | ethyl 2-[[4-(dipropylsulfamoyl)benzoyl]amino]-5,5,7,7-tetramethyl-4,6-dihydrothieno[2,3-c]pyridine-3-carboxylate;hydrochloride |
|---|---|
| PubChem CID | 18558643 |
| Molecular Formula | C27H40ClN3O5S2 |
| Molecular Weight | 586.22 g/mol |
| Exact Mass | 585.21 |
| IUPAC Name | ethyl 2-[[4-(dipropylsulfamoyl)benzoyl]amino]-5,5,7,7-tetramethyl-4,6-dihydrothieno[2,3-c]pyridine-3-carboxylate;hydrochloride |
| SMILES | CCCN(CCC)S(=O)(=O)c1ccc(C(=O)Nc2sc3c(c2C(=O)OCC)CC(C)(C)NC3(C)C)cc1.Cl |
| InChI | InChI=1S/C27H39N3O5S2.ClH/c1-8-15-30(16-9-2)37(33,34)19-13-11-18(12-14-19)23(31)28-24-21(25(32)35-10-3)20-17-26(4,5)29-27(6,7)22(20)36-24;/h11-14,29H,8-10,15-17H2,1-7H3,(H,28,31);1H |
| InChIKey | WUUSNSBBJUTFSY-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.22 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |