C24H32N2O4S — CID 4060868
methyl 2-[(4-butoxybenzoyl)amino]-5,5,7,7-tetramethyl-4,6-dihydrothieno[2,3-c]pyridine-3-carboxylate (PubChem CID 4060868) has the molecular formula C24H32N2O4S and a molecular weight of 444.60 g/mol. Its IUPAC name is methyl 2-[(4-butoxybenzoyl)amino]-5,5,7,7-tetramethyl-4,6-dihydrothieno[2,3-c]pyridine-3-carboxylate.
| Compound Name | methyl 2-[(4-butoxybenzoyl)amino]-5,5,7,7-tetramethyl-4,6-dihydrothieno[2,3-c]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 4060868 |
| Molecular Formula | C24H32N2O4S |
| Molecular Weight | 444.60 g/mol |
| Exact Mass | 444.21 |
| IUPAC Name | methyl 2-[(4-butoxybenzoyl)amino]-5,5,7,7-tetramethyl-4,6-dihydrothieno[2,3-c]pyridine-3-carboxylate |
| SMILES | CCCCOc1ccc(C(=O)Nc2sc3c(c2C(=O)OC)CC(C)(C)NC3(C)C)cc1 |
| InChI | InChI=1S/C24H32N2O4S/c1-7-8-13-30-16-11-9-15(10-12-16)20(27)25-21-18(22(28)29-6)17-14-23(2,3)26-24(4,5)19(17)31-21/h9-12,26H,7-8,13-14H2,1-6H3,(H,25,27) |
| InChIKey | NIKAAFGKLRIIFF-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.60 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|