C27H40ClN3O7S2 — CID 18558645
ethyl 2-[[4-[bis(2-methoxyethyl)sulfamoyl]benzoyl]amino]-5,5,7,7-tetramethyl-4,6-dihydrothieno[2,3-c]pyridine-3-carboxylate;hydrochloride (PubChem CID 18558645) has the molecular formula C27H40ClN3O7S2 and a molecular weight of 618.22 g/mol. Its IUPAC name is ethyl 2-[[4-[bis(2-methoxyethyl)sulfamoyl]benzoyl]amino]-5,5,7,7-tetramethyl-4,6-dihydrothieno[2,3-c]pyridine-3-carboxylate;hydrochloride.
| Compound Name | ethyl 2-[[4-[bis(2-methoxyethyl)sulfamoyl]benzoyl]amino]-5,5,7,7-tetramethyl-4,6-dihydrothieno[2,3-c]pyridine-3-carboxylate;hydrochloride |
|---|---|
| PubChem CID | 18558645 |
| Molecular Formula | C27H40ClN3O7S2 |
| Molecular Weight | 618.22 g/mol |
| Exact Mass | 617.20 |
| IUPAC Name | ethyl 2-[[4-[bis(2-methoxyethyl)sulfamoyl]benzoyl]amino]-5,5,7,7-tetramethyl-4,6-dihydrothieno[2,3-c]pyridine-3-carboxylate;hydrochloride |
| SMILES | CCOC(=O)c1c(NC(=O)c2ccc(S(=O)(=O)N(CCOC)CCOC)cc2)sc2c1CC(C)(C)NC2(C)C.Cl |
| InChI | InChI=1S/C27H39N3O7S2.ClH/c1-8-37-25(32)21-20-17-26(2,3)29-27(4,5)22(20)38-24(21)28-23(31)18-9-11-19(12-10-18)39(33,34)30(13-15-35-6)14-16-36-7;/h9-12,29H,8,13-17H2,1-7H3,(H,28,31);1H |
| InChIKey | KJMGFNZRIBRVMC-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 123.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.22 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |