C23H31ClN2O5S2 — CID 44989718
ethyl 2-[(4-ethylsulfonylbenzoyl)amino]-5,5,7,7-tetramethyl-4,6-dihydrothieno[2,3-c]pyridine-3-carboxylate;hydrochloride (PubChem CID 44989718) has the molecular formula C23H31ClN2O5S2 and a molecular weight of 515.10 g/mol. Its IUPAC name is ethyl 2-[(4-ethylsulfonylbenzoyl)amino]-5,5,7,7-tetramethyl-4,6-dihydrothieno[2,3-c]pyridine-3-carboxylate;hydrochloride.
| Compound Name | ethyl 2-[(4-ethylsulfonylbenzoyl)amino]-5,5,7,7-tetramethyl-4,6-dihydrothieno[2,3-c]pyridine-3-carboxylate;hydrochloride |
|---|---|
| PubChem CID | 44989718 |
| Molecular Formula | C23H31ClN2O5S2 |
| Molecular Weight | 515.10 g/mol |
| Exact Mass | 514.14 |
| IUPAC Name | ethyl 2-[(4-ethylsulfonylbenzoyl)amino]-5,5,7,7-tetramethyl-4,6-dihydrothieno[2,3-c]pyridine-3-carboxylate;hydrochloride |
| SMILES | CCOC(=O)c1c(NC(=O)c2ccc(S(=O)(=O)CC)cc2)sc2c1CC(C)(C)NC2(C)C.Cl |
| InChI | InChI=1S/C23H30N2O5S2.ClH/c1-7-30-21(27)17-16-13-22(3,4)25-23(5,6)18(16)31-20(17)24-19(26)14-9-11-15(12-10-14)32(28,29)8-2;/h9-12,25H,7-8,13H2,1-6H3,(H,24,26);1H |
| InChIKey | RYAHVSVHURBCSJ-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.10 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |