C22H25F3N2O3S — CID 3369210
ethyl 5,5,7,7-tetramethyl-2-[[3-(trifluoromethyl)benzoyl]amino]-4,6-dihydrothieno[2,3-c]pyridine-3-carboxylate (PubChem CID 3369210) has the molecular formula C22H25F3N2O3S and a molecular weight of 454.51 g/mol. Its IUPAC name is ethyl 5,5,7,7-tetramethyl-2-[[3-(trifluoromethyl)benzoyl]amino]-4,6-dihydrothieno[2,3-c]pyridine-3-carboxylate.
| Compound Name | ethyl 5,5,7,7-tetramethyl-2-[[3-(trifluoromethyl)benzoyl]amino]-4,6-dihydrothieno[2,3-c]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 3369210 |
| Molecular Formula | C22H25F3N2O3S |
| Molecular Weight | 454.51 g/mol |
| Exact Mass | 454.15 |
| IUPAC Name | ethyl 5,5,7,7-tetramethyl-2-[[3-(trifluoromethyl)benzoyl]amino]-4,6-dihydrothieno[2,3-c]pyridine-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)c2cccc(C(F)(F)F)c2)sc2c1CC(C)(C)NC2(C)C |
| InChI | InChI=1S/C22H25F3N2O3S/c1-6-30-19(29)15-14-11-20(2,3)27-21(4,5)16(14)31-18(15)26-17(28)12-8-7-9-13(10-12)22(23,24)25/h7-10,27H,6,11H2,1-5H3,(H,26,28) |
| InChIKey | HPTDVMPQEULSCO-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.51 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |