C20H26N2O3S2 — CID 41341232
ethyl 5,5,7,7-tetramethyl-2-[(2-thiophen-2-ylacetyl)amino]-4,6-dihydrothieno[2,3-c]pyridine-3-carboxylate (PubChem CID 41341232) has the molecular formula C20H26N2O3S2 and a molecular weight of 406.57 g/mol. Its IUPAC name is ethyl 5,5,7,7-tetramethyl-2-[(2-thiophen-2-ylacetyl)amino]-4,6-dihydrothieno[2,3-c]pyridine-3-carboxylate.
| Compound Name | ethyl 5,5,7,7-tetramethyl-2-[(2-thiophen-2-ylacetyl)amino]-4,6-dihydrothieno[2,3-c]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 41341232 |
| Molecular Formula | C20H26N2O3S2 |
| Molecular Weight | 406.57 g/mol |
| Exact Mass | 406.14 |
| IUPAC Name | ethyl 5,5,7,7-tetramethyl-2-[(2-thiophen-2-ylacetyl)amino]-4,6-dihydrothieno[2,3-c]pyridine-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)Cc2cccs2)sc2c1CC(C)(C)NC2(C)C |
| InChI | InChI=1S/C20H26N2O3S2/c1-6-25-18(24)15-13-11-19(2,3)22-20(4,5)16(13)27-17(15)21-14(23)10-12-8-7-9-26-12/h7-9,22H,6,10-11H2,1-5H3,(H,21,23) |
| InChIKey | SYRFZEVBAMFONR-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.57 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |