C23H27FN2O5S — CID 16619272
ethyl 2-[[2-(3-fluorobenzoyl)oxyacetyl]amino]-5,5,7,7-tetramethyl-4,6-dihydrothieno[2,3-c]pyridine-3-carboxylate (PubChem CID 16619272) has the molecular formula C23H27FN2O5S and a molecular weight of 462.54 g/mol. Its IUPAC name is ethyl 2-[[2-(3-fluorobenzoyl)oxyacetyl]amino]-5,5,7,7-tetramethyl-4,6-dihydrothieno[2,3-c]pyridine-3-carboxylate.
| Compound Name | ethyl 2-[[2-(3-fluorobenzoyl)oxyacetyl]amino]-5,5,7,7-tetramethyl-4,6-dihydrothieno[2,3-c]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 16619272 |
| Molecular Formula | C23H27FN2O5S |
| Molecular Weight | 462.54 g/mol |
| Exact Mass | 462.16 |
| IUPAC Name | ethyl 2-[[2-(3-fluorobenzoyl)oxyacetyl]amino]-5,5,7,7-tetramethyl-4,6-dihydrothieno[2,3-c]pyridine-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)COC(=O)c2cccc(F)c2)sc2c1CC(C)(C)NC2(C)C |
| InChI | InChI=1S/C23H27FN2O5S/c1-6-30-21(29)17-15-11-22(2,3)26-23(4,5)18(15)32-19(17)25-16(27)12-31-20(28)13-8-7-9-14(24)10-13/h7-10,26H,6,11-12H2,1-5H3,(H,25,27) |
| InChIKey | LDACKCRBADXIPK-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.54 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |