C21H24FN3O2S2 — CID 43968613
ethyl 2-[(6-fluoro-1,3-benzothiazol-2-yl)amino]-5,5,7,7-tetramethyl-4,6-dihydrothieno[2,3-c]pyridine-3-carboxylate (PubChem CID 43968613) has the molecular formula C21H24FN3O2S2 and a molecular weight of 433.57 g/mol. Its IUPAC name is ethyl 2-[(6-fluoro-1,3-benzothiazol-2-yl)amino]-5,5,7,7-tetramethyl-4,6-dihydrothieno[2,3-c]pyridine-3-carboxylate.
| Compound Name | ethyl 2-[(6-fluoro-1,3-benzothiazol-2-yl)amino]-5,5,7,7-tetramethyl-4,6-dihydrothieno[2,3-c]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 43968613 |
| Molecular Formula | C21H24FN3O2S2 |
| Molecular Weight | 433.57 g/mol |
| Exact Mass | 433.13 |
| IUPAC Name | ethyl 2-[(6-fluoro-1,3-benzothiazol-2-yl)amino]-5,5,7,7-tetramethyl-4,6-dihydrothieno[2,3-c]pyridine-3-carboxylate |
| SMILES | CCOC(=O)c1c(Nc2nc3ccc(F)cc3s2)sc2c1CC(C)(C)NC2(C)C |
| InChI | InChI=1S/C21H24FN3O2S2/c1-6-27-18(26)15-12-10-20(2,3)25-21(4,5)16(12)29-17(15)24-19-23-13-8-7-11(22)9-14(13)28-19/h7-9,25H,6,10H2,1-5H3,(H,23,24) |
| InChIKey | ALIPAGFBHWTTGD-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.57 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |