C19H21FN4OS2 — CID 43968614
2-[(6-fluoro-1,3-benzothiazol-2-yl)amino]-5,5,7,7-tetramethyl-4,6-dihydrothieno[2,3-c]pyridine-3-carboxamide (PubChem CID 43968614) has the molecular formula C19H21FN4OS2 and a molecular weight of 404.54 g/mol. Its IUPAC name is 2-[(6-fluoro-1,3-benzothiazol-2-yl)amino]-5,5,7,7-tetramethyl-4,6-dihydrothieno[2,3-c]pyridine-3-carboxamide.
| Compound Name | 2-[(6-fluoro-1,3-benzothiazol-2-yl)amino]-5,5,7,7-tetramethyl-4,6-dihydrothieno[2,3-c]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 43968614 |
| Molecular Formula | C19H21FN4OS2 |
| Molecular Weight | 404.54 g/mol |
| Exact Mass | 404.11 |
| IUPAC Name | 2-[(6-fluoro-1,3-benzothiazol-2-yl)amino]-5,5,7,7-tetramethyl-4,6-dihydrothieno[2,3-c]pyridine-3-carboxamide |
| SMILES | CC1(C)Cc2c(sc(Nc3nc4ccc(F)cc4s3)c2C(N)=O)C(C)(C)N1 |
| InChI | InChI=1S/C19H21FN4OS2/c1-18(2)8-10-13(15(21)25)16(27-14(10)19(3,4)24-18)23-17-22-11-6-5-9(20)7-12(11)26-17/h5-7,24H,8H2,1-4H3,(H2,21,25)(H,22,23) |
| InChIKey | VYYOCJCTRQJZIM-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.54 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |